Talk to us
08045479213
| Name of Product | 1,2,3-Tribromo Propane |
| CAS No | 96-11-7 |
| Formula | C3H5Br3 |
| IUPAC Name | 1,2,3-tribromopropane |
| InChI | InChI=1S/C3H5Br3/c4-1-3(6)2-5/h3H,1-2H2 |
| InChI Key | FHCLGDLYRUPKAM-UHFFFAOYSA-N |
| Canonical SMILES | C(C(CBr)Br)Br |
| EC Number | 202-478-8 |
| UNII | D2R8L96TOV |
| Description | Clear colorless To Yellow Liquid |
| Purity ( by GC) | Not less than 98.0 % |
| Water (KF) | Not more than 0.1 % |
| Acidity | Not more than 0.1 % |
| Other name / synonyms | |
| 1,2,3-TRIBROMOPROPANE | |
| s-Tribromopropane | |
| Glyceryl tribromohydrin | |
| 96-11-7 | |
| sym-Tribromopropane | |
| Glycerol tribromohydrin | |
| Propane, 1,2,3-tribromo- | |
| CCRIS 6706 | |
| EINECS 202-478-8 | |
| NSC 78932 | |
| BRN 1732082 | |
| AI3-18135 | |
| 1,3-Tribromopropane | |
| Propane,2,3-tribromo- | |
| AC1L1OES | |
| 1,2,3-tribromo-propane | |
| UNII-D2R8L96TOV | |
| AC1Q27JA | |
| D2R8L96TOV | |
| NCIOpen2_004459 | |
| SCHEMBL66165 | |
| KSC491K9T | |
| ACMC-20978r | |
| 148474_ALDRICH | |
| AC1Q27J9 | |
| CHEBI:18859 | |
| CTK3J1599 | |
| FHCLGDLYRUPKAM-UHFFFAOYSA-N | |
| MolPort-001-779-772 | |
| NSC78932 | |
| ANW-13657 | |
| NSC-78932 | |
| AKOS000120060 | |
| MCULE-7323713039 | |
| RL06082 | |
| RTR-038601 | |
| DB-057620 | |
| KB-148139 | |
| LS-121073 | |
| TR-038601 | |
| FT-0606223 | |
| ST50409751 | |
| Unavailable - See ASDI_CatNo 500027841 | |
| 4-01-00-00221 (Beilstein Handbook Reference) | |
| I14-0910 | |
| InChI=1/C3H5Br3/c4-1-3(6)2-5/h3H,1-2H | |
| 3B3-036541 |

Price:
Other Names : 11Bromoundecanoic acid
Purity : 98% min
Density : 1.23 Gram per cubic centimeter(g/cm3)
Usage : Specialty chemical manufacturing, lab reagent, research
Structural Formula : Br(CH2)10COOH
Classification : Other, Carboxylic Acid
Other Names : 1Bromo1phenylbutane, Bromophenylbutane
Purity : 98% minimum
Density : 1.233 Gram per cubic centimeter(g/cm3)
Usage : Laboratory research, synthesis of specialty chemicals
Structural Formula : C6H5CH2CH2CH2Br
Classification : Other, Organic Intermediate
Other Names : EAA, Ethyl 3Oxobutanoate
Purity : 99% min
Density : 1.034 Gram per cubic centimeter(g/cm3)
Usage : Intermediate in organic synthesis
Structural Formula : CH3COCH2COOC2H5
Classification : Organic Acids
Other Names : 1Bromo2ethylhexane
Purity : 99%
Density : 1.185 Gram per cubic centimeter(g/cm3)
Usage : Organic synthesis and pharmaceutical intermediate
Structural Formula : CH3(CH2)3CH(C2H5)CH2Br
Classification : Halogenated Hydrocarbon, Other