| Name of Product | 4-Bromo Chlorobenzene |
| CAS No | 106-39-8 |
| Formula | C6H4BrCl |
| IUPAC Name | 1-bromo-4-chlorobenzene |
| InChI | ISO CertifiedInChI=1S/C6H4BrCl/c7-5-1-3-6(8)4-2-5/h1-4H |
| InChI Key | NHDODQWIKUYWMW-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1Cl)Br |
| EC Number | 203-392-3 |
| Description | White to off white crystalline Powder |
| Purity ( by GC) | Not less than 98.50 % |
| 1-Bromo-4-chlorobenzene | |
| Other name / synonyms | 4-BROMOCHLOROBENZENE |
| 106-39-8 | |
| p-Bromochlorobenzene | |
| 4-Chlorobromobenzene | |
| p-Chlorophenyl bromide | |
| p-Chlorobromobenzene | |
| Benzene, 1-bromo-4-chloro- | |
| 4-Chlorophenyl bromide | |
| 1-Chloro-4-bromobenzene | |
| 4-Chloro-1-bromobenzene | |
| p-Bromophenyl chloride | |
| 4-bromo-1-chlorobenzene | |
| p-Bromoclorobenzene | |
| NSC 17587 | |
| 1-bromo-4-chloro-benzene | |
| NHDODQWIKUYWMW-UHFFFAOYSA-N | |
| EINECS 203-392-3 | |
| SBB060209 | |
| AI3-15313 | |
| 4-chlorobromobenzol | |
| 4-bromo chlorobenzene | |
| 4-bromo-chlorobenzene | |
| 4-chloro-bromobenzene | |
| 1-bromo4-chlorobenzene | |
| PubChem10226 | |
| AC1L1PLC | |
| AC1Q3MWU | |
| UNII-LXY3B1SO4F | |
| LXY3B1SO4F | |
| ACMC-2098jj | |
| AC1Q3II1 | |
| B60428_ALDRICH | |
| KSC179A8P | |
| SCHEMBL197605 | |
| 442403_SUPELCO | |
| Jsp000581 | |
| 16660_FLUKA | |
| CTK0H9087 | |
| MolPort-001-760-872 | |
| NSC17587 | |
| STR00662 | |
| ANW-15341 | |
| AR-1C2003 | |
| NSC-17587 | |
| ZINC00404309 | |
| AKOS000202636 | |
| DF10076 | |
| MCULE-2703502243 | |
| MP-2178 | |
| RP25112 | |
| RTC-064094 | |
| TRA0100084 | |
| AJ-22317 | |
| AK-98696 | |
| AM807352 | |
| BC207086 | |
| CJ-04001 | |
| KB-37363 | |
| LS-29193 | |
| SC-00247 | |
| TL806198 | |
| AB1002812 | |
| KB-204420 | |
| KB-204427 | |
| ST2408723 | |
| TC-064094 | |
| B0571 | |
| ST50406320 | |
| I01-0461 | |
| F0001-0118 | |
| InChI=1/C6H4BrCl/c7-5-1-3-6(8)4-2-5/h1-4 | |
| UNII-Z0W07Y466G component NHDODQWIKUYWMW-UHFFFAOYSA-N | |

Price:
Minimum Order Quantity : 1 Kilograms
Molecular Weight : 102.13 g/mol
Application : Solvent in coatings, inks, and fragrances
Smell : Other, Pleasant, fruity
Structural Formula : CH3COOCH2CH2CH3
Usage : Industrial solvent, fragrance ingredient
Minimum Order Quantity : 1 Kilograms
Molecular Weight : 42.39 g/mol
Application : Pharmaceuticals, Drying Agent, Electrolyte in lithiumion batteries, metallurgy, laboratory reagent
Smell : Other, Odorless
Structural Formula : Li Cl
Usage : Used as a desiccant, flux, and in lithium batteries manufacturing
Minimum Order Quantity : 1 Kilograms
Molecular Weight : 102.13 g/mol
Application : Solvent in coatings inks and industrial cleaning
Smell : Other, Sweet fruity odor
Structural Formula : CH3COOCH2CH2CH3
Usage : Used as a solvent in various applications including coatings and cleaners
Minimum Order Quantity : 1 Kilograms
Molecular Weight : 193.13 g/mol
Application : Organic synthesis, pharmaceuticals, agrochemicals, intermediates
Smell : Other, Characteristic, mild
Structural Formula : CH3(CH2)7Br
Usage : Used as a chemical intermediate, in preparation of surfactants, for research and development