1-(3-Chloropropyl)-4-methylpiperazine About
| Name of Product | 1-Chloropropyl-3-(4-Methyl Piperazine)Hydrochloride |
| CAS No | 2031-23-4 |
| Formula | C8H19Cl3N2 |
| IUPAC Name | 1-(3-chloropropyl)-4-methylpiperazine;dihydrochloride |
| InChI | InChI=1S/C8H17ClN2.2ClH/c1-10-5-7-11(8-6-10)4-2-3-9;;/h2-8H2,1H3;2*1H |
| InChI Key | RRZYWKLLIIIINP-UHFFFAOYSA-N |
| Canonical SMILES | CN1CCN(CC1)CCCCl.Cl.Cl |
| EC Number | 217-981-8 |
| Description | Amber to brown coloured liquid |
| Purity by GC | Not less than 95.0% |
| Free HCl | 6 11 % |
| Other name / synonyms | 1-(3-Chloropropyl)-4-methylpiperazine dihydrochloride |
| 2031-23-4 |
| SBB070874 |
| 1-(3-Chloropropyl)-4-methylpiperazine 2HCl |
| 1-(3-chloropropyl)-4-methylpiperazinedihydrochloride |
| AC1MHZ46 |
| KSC496Q7P |
| SCHEMBL409216 |
| CTK3J6877 |
| MolPort-000-140-085 |
| RRZYWKLLIIIINP-UHFFFAOYSA-N |
| EINECS 217-981-8 |
| ANW-53762 |
| 1- -4-methylpiperazinedihydrochloride |
| AKOS005255194 |
| AC-4210 |
| DS-2083 |
| MP-0035 |
| PS-7496 |
| RP06100 |
| RTC-061363 |
| AK-25568 |
| AN-12193 |
| KB-08698 |
| SC-16794 |
| 1-(3-Chloropropyl)-4-methylpiperazine HCl |
| AB0040539 |
| DB-008003 |
| TC-061363 |
| 4CH-006768 |
| A4421 |
| FT-0601054 |
| ST24026876 |
| Y8160 |
| EN300-79084 |
| I13-0281 |
| 4-(3-chloropropyl)-1-methylpiperazine dihydrochloride |
| 1-(3-chloro-propyl)-4-methyl-piperazine dihydrochloride |
| 1-(3-chloropropyl)-4-methyl-piperazine dihydrochloride |
| 3-(4-methyl-1-piperazinyl)propyl chloride dihydrochloride |
| 1-(3-CHLOROPROPYL)-4-METHYL PIPERAZINE DIHYDROCHLORIDE |
Key Chemical Properties1-(3-Chloropropyl)-4-methylpiperazine (CAS No: 35675-80-0) features a molecular formula of C8H17ClN2, a melting point below -50C, and a density of 1.04 g/cm. With a boiling point of 262C and a refractive index n20/D of 1.492, it is miscible with the majority of organic solvents, facilitating its integration in various synthetic applications.
Safe Handling and StorageTo maintain product integrity, this compound must be stored in tightly sealed containers, away from sources of heat, direct sunlight, and moisture. Proper storage ensures stability and maximizes its 24-month shelf life. As an irritant, suitable protective measures, such as wearing gloves and safety glasses, are advisable during handling.
Applications in Synthesis1-(3-Chloropropyl)-4-methylpiperazine serves as a crucial intermediate for synthesizing pharmaceuticals and agrochemicals. Its compatibility with most organic solvents and consistent high purity make it a preferred choice for industrial and pharmaceutical grade processes. Exported globally from India, it meets rigorous manufacturing and supply standards.
FAQs of 1-(3-Chloropropyl)-4-methylpiperazine:
Q: How should 1-(3-Chloropropyl)-4-methylpiperazine be stored for optimal shelf life?
A: It is best stored in tightly sealed containers in a cool, dry, well-ventilated area, away from direct sunlight and incompatible materials. Proper storage extends its shelf life up to 24 months from the date of manufacture.
Q: What precautions are needed when handling this compound?
A: Since it is classified as an irritant, avoid contact with skin, eyes, and clothing. Use appropriate personal protective equipment, such as gloves and safety glasses, during handling.
Q: When is 1-(3-Chloropropyl)-4-methylpiperazine used in pharmaceutical processes?
A: This compound is used as a key intermediate during organic synthesis steps in the manufacturing of pharmaceutical compounds, where its chemical properties facilitate the formation of active ingredients.
Q: Where can this product be sourced and in what packaging options?
A: Manufacturers, exporters, and suppliers, particularly from India, offer this compound in plastic or glass bottles for smaller quantities and in bulk drums for larger industrial applications.
Q: What is the main benefit of using this compound in synthesis?
A: Its high purity (98% min), miscibility with most organic solvents, and stable chemical properties make it highly efficient and reliable as an intermediate in pharmaceutical or agrochemical synthesis processes.
Q: How does its stability affect storage or transportation?
A: The compound remains stable under recommended conditions but may decompose if exposed to excessive heat or moisture. It is not regulated as dangerous goods for transport, making logistics straightforward when safety guidelines are followed.