Talk to us
08045479213
| Name of Product | Isobutyl Bromide |
| 1-Bromo-2-methylpropane | |
| CAS No | 78-77-3 |
| Formula | (CH3)2CHCH2Br |
| IUPAC Name | 1-bromo-2-methylpropane |
| InChI | InChI=1S/C4H9Br/c1-4(2)3-5/h4H,3H2,1-2H3 |
| InChI Key | HLVFKOKELQSXIQ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CBr |
| EC Number | 201-141-2 |
| UN Number | 2342 |
| UNII | 5OEC0BW987 |
| Description | Clear, colourless to pale yellow liquid |
| Water | Not more than 0.1 % |
| Acidity | Not more than 0.1 % as HBr |
| Purity by GC | Not less than 99.0% |
| Other name / synonyms | 1-Bromo-2-methylpropane |
| ISOBUTYL BROMIDE | |
| iso-Butyl bromide | |
| 78-77-3 | |
| Propane, 1-bromo-2-methyl- | |
| Bromoisobutane | |
| i-Butyl bromide | |
| 1-Bromo-2-methyl-propane | |
| UNII-5OEC0BW987 | |
| CCRIS 349 | |
| HLVFKOKELQSXIQ-UHFFFAOYSA-N | |
| NSC 8416 | |
| EINECS 201-141-2 | |
| AI3-18130 | |
| isobutylbromide | |
| i-butylbromide | |
| iso-butylbromide | |
| isobutyl-bromide | |
| 2-methylbromopropane | |
| sJPHAbIKUP@ | |
| 2-methylpropylbromide | |
| iso-C4H9Br | |
| 2-methyl bromopropane | |
| 2-methylpropyl bromide | |
| BrCH2CHMe2; | |
| ACMC-1BLAD | |
| l-bromo-2-methylpropane | |
| 2-methyl-1-bromopropane | |
| 3-bromo-2-methylpropane | |
| AC1L1MSG | |
| 1 -bromo-2-methylpropane | |
| 1-bromo-2-methyl propane | |
| AC1Q27JY | |
| SCHEMBL7399 | |
| DSSTox_CID_31112 | |
| DSSTox_GSID_52539 | |
| KSC377A7R | |
| 156582_ALDRICH | |
| 5OEC0BW987 | |
| AC1Q1P25 | |
| CHEMBL346532 | |
| 58510_FLUKA | |
| CTK2H7078 | |
| WLN: E1Y1&1 | |
| NSC8416 | |
| MolPort-001-779-904 | |
| BB_SC-6824 | |
| NSC-8416 | |
| Tox21_303878 | |
| ANW-37218 | |
| AR-1C1952 | |
| SBB059932 | |
| STL264117 | |
| ZINC01586727 | |
| AKOS000118762 | |
| EBD2638203 | |
| MCULE-6039420480 | |
| RP20323 | |
| RTC-030984 | |
| TRA0041920 | |
| UN 2342 | |
| CAS-78-77-3 | |
| NCGC00357138-01 | |
| AN-23958 | |
| CJ-25284 | |
| KB-64977 | |
| LS-119649 | |
| TC-030984 | |
| A9430 | |
| B0616 | |
| FT-0085081 | |
| FT-0607463 | |
| FT-0627385 | |
| ST51046199 | |
| 3B4-0628 | |
| I14-0216 | |
| I14-108090 | |
| InChI=1/C4H9Br/c1-4(2)3-5/h4H,3H2,1-2H |

Price:
Solubility : Soluble in water ethanol
Raw Material : Acetic acid and lithium compounds
Appearance : White crystalline powder
Smell : Odorless, Other
Other Names : Lithium acetate hydrate
Purity : 99%
Solubility : Partially soluble in water soluble in organic solvents
Raw Material : Acetic acid and methanol
Appearance : Colorless liquid
Smell : Other, Fruity odor
Other Names : Acetic acid methyl ester Methyl ethanoate
Purity : 85% & 99%
Solubility : Slightly soluble in water; soluble in alcohol and ether
Raw Material : Acetic acid chlorine
Appearance : Colorless liquid
Smell : Other, Characteristic pungent odor
Other Names : Chloromethyl Acetate
Purity : 99%
Solubility : Insoluble in water soluble in organic solvents
Raw Material : Benzene derivative
Appearance : Colorless liquid
Smell : Aromatic odor, Other
Other Names : 4Bromo1fluorobenzene Para Bromo Fluoro Benzene
Purity : 99%