Talk to us
08045479213
| Name of Product | 11 bromoundecanoic Acid |
| CAS No | 2834-05-1 |
| Formula | Br(CH2)10COOH |
| IUPAC Name | 11-bromoundecanoic acid |
| InChI | InChI=1S/C11H21BrO2/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h1-10H2,(H,13,14) |
| InChI Key | IUDGNRWYNOEIKF-UHFFFAOYSA-N |
| Canonical SMILES | C(CCCCCBr)CCCCC(=O)O |
| EC Number | 220-602-9 |
| Description : | Off white to beige coloured powder |
| Loss on drying | Not more than 0.5 % |
| Assay | Not less than 98.0 % |
| Other name / synonyms | 11-BROMOUNDECANOIC ACID |
| 5/1/2834 | |
| Undecanoic acid, 11-bromo- | |
| 11-bromo-undecanoic acid | |
| 11-Bromoundecanoic Acid,Tech | |
| IUDGNRWYNOEIKF-UHFFFAOYSA-N | |
| 11-Bromodecanoic acid | |
| 11bromoundecanoic acid | |
| AC1L2AQN | |
| 11-Bromohendecanoic Acid | |
| 11-Bromo undecanoic acid | |
| SCHEMBL52426 | |
| B82804_ALDRICH | |
| KSC489Q1H | |
| ACMC-2097c2 | |
| 165816_ALDRICH | |
| CTK3I9813 | |
| MolPort-000-701-213 | |
| BB_SC-5444 | |
| NSC14781 | |
| EINECS 220-602-9 | |
| ANW-13776 | |
| BBL027401 | |
| LMFA01090005 | |
| NSC 14781 | |
| NSC-14781 | |
| SBB061375 | |
| STK709233 | |
| AKOS005522625 | |
| AM84878 | |
| LS40413 | |
| MCULE-9911407009 | |
| NE10224 | |
| RP29440 | |
| RP29441 | |
| RTR-012522 | |
| TRA0059984 | |
| AJ-28836 | |
| AK-54019 | |
| N745 | |
| SC-53353 | |
| KB-217621 | |
| TR-012522 | |
| B0389 | |
| FT-0653215 | |
| ST24038233 | |
| ST51047395 | |
| A22884 | |
| I04-0434 | |
| 3B3-032864 | |
| 11-Bromo-1-Undecanoic Acid;Undecanoic acid, 11-bromo-;Bromoundecanoicacid |

Price:
Application : Pharmaceutical Intermediates, Synthesis of chemicals
Raw Material : Isopropanol, Chloroacetic acid
Boiling point : 164166C
Classification : Organic Acids
Appearance : Colorless to pale yellow liquid
Molecular Weight : 136.58 g/mol
Application : Pharmaceuticals, Drying Agent, Electrolyte in lithiumion batteries, metallurgy, laboratory reagent
Raw Material : Lithium carbonate, Hydrochloric acid
Boiling point : 1382C
Classification : Other, Inorganic Salt
Appearance : White crystalline powder
Molecular Weight : 42.39 g/mol
Application : Air Conditioning, Absorption Refrigeration, Industrial Drying, Heat Transfer Fluid
Raw Material : Lithium Carbonate, Hydrobromic Acid
Boiling point : ~126.5 C (solution)
Classification : Other, Inorganic Chemical
Appearance : Colorless to pale yellow solution
Molecular Weight : 86.85 g/mol
Application : Used as an intermediate in organic synthesis
Raw Material : Pentanol
Boiling point : 130132C
Classification : Other, Halogenated hydrocarbon
Appearance : Colorless liquid
Molecular Weight : 151.05 g/mol