About Methyl - 3 - Oxopentanoate
| Name of Product | Methyl 3 -Oxopentanoate |
| CAS No | 6149-41-3 |
| Formula | C5H10O3 |
| IUPAC Name | methyl 3-nitrobenzoate |
| InChI | InChI=1S/C8H7NO4/c1-13-8(10)6-3-2-4-7(5-6)9(11)12/h2-5H,1H3 |
| InChI Key | AXLYJLKKPUICKV-UHFFFAOYSA-N |
| Canonical SMILES | COC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| EC Number | 210-573-0 |
| Other name / synonyms | Methyl 3-hydroxybutanoate |
| Methyl 3-hydroxybutyrate |
| Methyl-3-hydroxybutyrate |
| BUTYRIC ACID, 3-HYDROXY-, METHYL ESTER |
| (R)-Methyl3-Hydroxybutanoate |
| (S)-Methyl3-Hydroxybutanoate |
| 1487-49-6 |
| EINECS 216-068-1 |
| Butanoic acid, 3-hydroxy-, methyl ester |
| Methyl (S)-3-hydroxybutyrate |
| Methyl (R)-3-hydroxybutanoate |
| Butanoic acid, 3-hydroxy-, methyl ester, (S)- |
| formyl 3-hydroxy-butanoate |
| ACMC-209j7i |
| ACMC-209l8o |
| SCHEMBL53570 |
| Methyl .beta.-hydroxybutyrate |
| AC1L259E |
| CH3CH(OH)CH2C(O)OCH3 |
| CTK4C5920 |
| LDLDJEAVRNAEBW-UHFFFAOYSA- |
| LDLDJEAVRNAEBW-UHFFFAOYSA-N |
| MolPort-006-113-331 |
| EINECS 223-610-0 |
| EINECS 258-628-8 |
| LMFA07010513 |
| AKOS009156905 |
| NE22129 |
| TRA0046335 |
| TRA0058238 |
| Butanoic acid,3-hydroxy-, methyl ester |
| .beta.-Hydroxybutyric acid, methyl ester |
| AN-17298 |
| AN-17299 |
| LS-48063 |
| WE(1:0/4:0(3OH)) |
| A6637 |
| FT-0605058 |
| Z3246 |
| I14-4761 |
| I14-4762 |
| 3B3-024339 |
| InChI=1/C5H10O3/c1-4(6)3-5(7)8-2/h4,6H,3H2,1-2H3 |
Versatile Chemical Intermediate for Multiple IndustriesMethyl-3-Oxopentanoate is prized for its role as a key intermediate in chemical and pharmaceutical synthesis. Its purity and reactivity make it suitable for manufacturing not only pharmaceuticals but also agrochemicals and dyes, enabling streamlined production processes across sectors. This compound is essential for research labs and commercial facilities needing reliable, high-quality reagents.
Safe Storage and Handling EmphasizedDue to its flammable liquid and vapor properties, safe storage of Methyl-3-Oxopentanoate is crucial. It should be kept in a cool, dry, and well-ventilated area, distinctly away from heat, ignition sources, and strong oxidizers. Following manufacturer-recommended safety protocols, including using secure packaging and proper personal protective equipment, ensures safety and prolongs the products 24-month shelf life.
FAQs of Methyl - 3 - Oxopentanoate:
Q: How should Methyl-3-Oxopentanoate be safely stored and handled?
A: Methyl-3-Oxopentanoate should be stored in a cool, dry, well-ventilated area, away from sources of ignition and incompatible materials such as strong oxidizing agents. As it is a flammable liquid and vapor, handle with care, use appropriate protective gear, and ensure containers are tightly closed when not in use.
Q: What are the primary applications of Methyl-3-Oxopentanoate?
A: This compound is mainly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and dyes. Its high purity and favorable reactivity make it a valuable ingredient in various chemical manufacturing processes.
Q: When does the shelf life of Methyl-3-Oxopentanoate expire, and how is shelf stability ensured?
A: The shelf life is 24 months under recommended storage conditions. Keeping the product in its original, sealed packaging away from heat sources and moisture ensures optimal stability and prevents degradation.
Q: Where is Methyl-3-Oxopentanoate typically supplied from and how is it packaged?
A: This product is available from manufacturers, exporters, and suppliers in India. It is packaged in 200 kg drums or ISO tanks to facilitate secure storage and transportation.
Q: What processes utilize Methyl-3-Oxopentanoate in chemical synthesis?
A: Methyl-3-Oxopentanoate is frequently involved as a building block in condensation, alkylation, and acylation reactions, serving as a reagent in the creation of complex molecules needed in pharmaceuticals and fine chemicals.
Q: What are the benefits of using Methyl-3-Oxopentanoate in manufacturing and laboratory settings?
A: Its high purity (98% min.), predictable reactivity, and solubility profile make it ideal for specialized syntheses, ensuring consistent results and reducing impurities in finished products. Its fruity odor and manageable physical properties also aid in safer handling.