Talk to us
08045479213
Send InquiryMethyl Acetate 99%
MOQ : 1 Kilograms
Methyl Acetate 99% Specification
- Molecular Formula
- C3H6O2
- Boiling point
- 56.9 C
- Smell
- Pleasant, Fruity Odor
- Molecular Weight
- 74.08 g/mol
- Taste
- Sweet, Fruity
- Structural Formula
- CH3COOCH3
- HS Code
- 2915 31 00
- Refractive Rate
- 1.361 at 20C
- Grade
- Industrial Grade
- Purity
- 99%
- Application
- Industrial Solvent, Paints & Coatings, Adhesives, Inks
- Appearance
- Clear, Colorless Liquid
- CAS No
- 79-20-9
- EINECS No
- 201-185-2
- Other Names
- Acetic Acid Methyl Ester; Methyl Ethanoate
- Usage
- Used as a fast-evaporating solvent
- Melting Point
- 98 C
- Density
- 0.93 Gram per cubic centimeter(g/cm3)
- Solubility
- Soluble in water (25 g/L at 20C); miscible with most organic solvents
- Raw Material
- Methanol and Acetic Acid
- Storage
- Store in cool, dry, well-ventilated area away from heat and ignition sources
- UN Number
- 1231
- Packing
- 200 Litre Drum / IBC Tank
- Shelf Life
- 2 Years
- pH
- Not applicable (neutral ester)
- Stability
- Stable under recommended storage conditions
- Viscosity
- 0.37 mPas at 25C
- Hazard Class
- Flammable Liquid (Class 3)
- Autoignition Temperature
- 454 C
- Flash Point
- -10 C (Closed Cup)
- Vapour Pressure
- 24.9 kPa at 20C
Methyl Acetate 99% Trade Information
- Minimum Order Quantity
- 1 Kilograms
- Supply Ability
- 100 Kilograms Per Month
- Delivery Time
- 7 Days
About Methyl Acetate 99%
| Name of Product | Methyl Acetate 99% | IUPAC Name | methyl acetate |
| CAS No | 79-20-9 | InChI | InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3 |
| Formula | CH3COOCH3. | InChI Key | KXKVLQRXCPHEJC-UHFFFAOYSA-N |
| Other name / synonyms | METHYL ACETATE | Canonical SMILES | CC(=O)OC |
|
|
79-20-9 | CAS | 79-20-9 |
|
|
Devoton | EC Number | 201-185-2 |
|
|
Tereton | ICSC Number | 507 |
|
|
Methyl ethanoate | RTECS Number | AI9100000 |
|
|
Acetic acid, methyl ester | UN Number | 1231 |
|
|
Methylacetat | NII | W684QT396F |
|
|
Acetate de methyle | Wikipedia | Methyl acetate |
|
|
Acetic acid methyl ester |
|
|
|
|
Methyl acetic ester | Description | Clear, colourless liquid |
|
|
Methylacetaat | Acidity | Not more than 0.5 % |
|
|
Metile (acetato di) | Moisture (KF) | Not more than 0.5 % |
|
|
Methyle (acetate de) | Purity by GC | Not less than 99.0% |
|
|
Octan metylu |
|
|
|
|
Methylester kiseliny octove |
|
|
|
|
Ethyl ester of monoacetic acid |
|
|
|
|
Methylacetaat [Dutch] |
|
|
|
|
Methylacetat [German] |
|
|
|
|
Octan metylu [Polish] |
|
|
|
|
CH3COOCH3 |
|
|
|
|
FEMA Number 2676 |
|
|
|
|
Methyl acetate (natural) |
|
|
|
|
NSC 405071 |
|
|
|
|
Acetate de methyle [French] |
|
|
|
|
HSDB 95 |
|
|
|
|
UNII-W684QT396F |
|
|
|
|
FEMA No. 2676 |
|
|
|
|
CCRIS 5846 |
|
|
|
|
Methyle (acetate de) [French] |
|
|
|
|
Metile (acetato di) [Italian] |
|
|
|
|
CHEBI:77700 |
|
|
|
|
KXKVLQRXCPHEJC-UHFFFAOYSA-N |
|
|
|
|
Methylester kiseliny octove [Czech] |
|
|
|
|
EINECS 201-185-2 |
|
|
|
|
UN1231 |
|
|
|
|
NCGC00090940-01 |
|
|
|
|
DSSTox_CID_1767 |
|
|
|
|
DSSTox_RID_76314 |
|
|
|
|
DSSTox_GSID_21767 |
|
|
|
|
CAS-79-20-9 |
|
|
|
|
AcOMe |
|
|
|
|
MeOAc |
|
|
|
|
1-Methyl acetate |
|
|
|
|
METHYL-ACETATE |
|
|
|
|
ACMC-209tiz |
|
|
|
|
AC1L1MUS |
|
|
|
|
CH3CO2CH3 |
|
|
|
|
Methyl ester of acetic acid |
|
|
|
|
KSC378E1T |
|
|
|
|
WLN: 1VO1 |
|
|
|
|
CHEMBL14079 |
|
|
|
|
W267600_ALDRICH |
|
|
|
|
W267619_ALDRICH |
|
|
|
|
METHYL ACETATE, 97% |
|
|
|
|
186325_ALDRICH |
|
|
|
|
296996_ALDRICH |
|
|
|
|
AC1Q44F6 |
|
|
|
|
ACETIC ACID,METHYL ESTER |
|
|
|
|
45997_FLUKA |
|
|
|
|
45998_FLUKA |
|
|
|
|
45999_FLUKA |
|
|
|
|
CTK2H8219 |
|
|
|
|
MolPort-001-783-796 |
|
|
|
|
45999_SIAL |
|
|
|
|
W684QT396F |
|
|
|
|
186325_SIAL |
|
|
|
|
296996_SIAL |
|
|
|
|
Tox21_113243 |
|
|
|
|
Tox21_200057 |
|
|
|
|
ANW-42537 |
|
|
|
|
NSC405071 |
|
|
|
|
STL281977 |
|
|
|
|
ZINC01597766 |
|
|
|
|
AKOS000120042 |
|
|
|
|
LS-1774 |
|
|
|
|
MCULE-7368066093 |
|
|
|
|
NSC-405071 |
|
|
|
|
RL05058 |
|
|
|
|
RTR-037852 |
|
|
|
|
TRA0094982 |
|
|
|
|
UN 1231 |
|
|
|
|
NCGC00090940-02 |
|
|
|
|
NCGC00257611-01 |
|
|
|
|
AN-23982 |
|
|
|
|
CJ-25643 |
|
|
|
|
KB-54707 |
|
|
|
|
TR-037852 |
|
|
|
|
FT-0600347 |
|
|
|
|
FT-0621748 |
|
|
|
|
LT00785639 |
|
|
|
|
S0300 |
|
|
|
|
Z1774 |
|
|
|
|
Methyl acetate [UN1231] [Flammable liquid] |
|
|
|
|
7727-EP2269975A2 |
|
|
|
|
7727-EP2269986A1 |
|
|
|
|
7727-EP2269997A2 |
|
|
|
|
7727-EP2272822A1 |
|
|
|
|
7727-EP2275407A1 |
|
|
|
|
7727-EP2275415A2 |
|
|
|
|
7727-EP2280001A1 |
|
|
|
|
7727-EP2281821A1 |
|
|
|
|
7727-EP2284169A1 |
|
|
|
|
7727-EP2284174A1 |
|
|
|
|
7727-EP2287152A2 |
|
|
|
|
7727-EP2287161A1 |
|
|
|
|
7727-EP2287162A1 |
|
|
|
|
7727-EP2289509A2 |
|
|
|
|
7727-EP2292597A1 |
|
|
|
|
7727-EP2292609A1 |
|
|
|
|
7727-EP2295406A1 |
|
|
|
|
7727-EP2298750A1 |
|
|
|
|
7727-EP2298756A1 |
|
|
|
|
7727-EP2305642A2 |
|
|
|
|
7727-EP2305666A1 |
|
|
|
|
7727-EP2305667A2 |
|
|
|
|
7727-EP2305683A1 |
|
|
|
|
7727-EP2305825A1 |
|
|
|
|
7727-EP2308857A1 |
|
|
|
|
7727-EP2308864A1 |
|
|
|
|
7727-EP2311839A1 |
|
|
|
|
7727-EP2314589A1 |
|
|
|
|
7727-EP2316837A1 |
|
|
|
|
7727-EP2380568A1 |
|
|
|
|
C17530 |
|
|
|
|
Methyl acetate [UN1231] [Flammable liquid] |
|
|
|
|
InChI=1/C3H6O2/c1-3(4)5-2/h1-2H |
|
|
|
|
A839618 |
|
|
|
|
3B4-0094 |
|
|
|
|
I14-2599 |
|
|
|
|
LS-88071 |
|
|
|
|
S261 |
|
|
|
|
CAS-10377-48-7 |
|
|
|
|
RT-001069 |
|
|
|
|
D08137 |
|
|
|
|
|
|
|
Efficient and Fast-Evaporating Solvent
Methyl Acetate 99% features a low boiling point of 56.9C and a high vapor pressure, making it ideal for applications requiring fast drying. Its solubility in water (25 g/L at 20C) and miscibility with many organic solvents allow for versatile formulation, particularly in the manufacturing of coatings, adhesives, and inks.
Safe Storage and Handling Guidelines
As a flammable liquid (Hazard Class 3, UN 1231), Methyl Acetate must be stored in cool, dry, and well-ventilated conditions, away from heat or ignition sources. Following these guidelines preserves both its stability and effectiveness, and complies with regulatory requirements, while minimizing risks during storage and use.
Applications Across Diverse Industries
This solvents rapid evaporation and neutrality make it an invaluable ingredient in a variety of industries. Its primary uses span industrial solvents, paints, coatings, adhesives, and inks, where it enhances application efficiency and finish aesthetics thanks to its unique physical and chemical properties.
FAQs of Methyl Acetate 99
Q: How should Methyl Acetate 99% be stored to maintain its stability and shelf life?
A: Store Methyl Acetate 99% in a cool, dry, well-ventilated area, away from heat, sparks, and open flames. Use tightly sealed containers such as 200-litre drums or IBC tanks and avoid exposure to direct sunlight. Proper storage under recommended conditions preserves stability and ensures a shelf life of up to two years.Q: What are the primary industrial applications of Methyl Acetate 99%?
A: Methyl Acetate 99% is primarily used as a fast-evaporating solvent in the manufacturing of paints, coatings, adhesives, and inks. Its rapid drying properties enhance efficiency and surface finish, making it a preferred choice in the chemical and surface treatment industries.Q: When should Methyl Acetate be handled with extra caution?
A: Due to its low flash point (10C) and high vapor pressure, extra caution is needed whenever handling Methyl Acetate near ignition sources or at elevated temperatures. Always use suitable protective equipment and ensure the area is well-ventilated to avoid flammable vapor accumulation.Q: Where is Methyl Acetate 99% commonly used?
A: Methyl Acetate is widely utilized in industrial environments across India and globally. Paint manufacturers, adhesive producers, and printing ink formulators commonly use this solvent due to its effective solubilizing and fast evaporation features.Q: What benefits does using Methyl Acetate 99% offer over other solvents?
A: Methyl Acetate 99% provides quick evaporation, low viscosity, and excellent solubility, leading to rapid drying times and improved productivity. Its pleasant odor and minimal toxicity make it a safer alternative in many formulations, while its high purity and stability ensure consistent performance.Q: How is Methyl Acetate industrially produced?
A: Methyl Acetate is produced by the esterification of methanol and acetic acid, resulting in a neutral ester (pH not applicable) classified as a carboxylic acid ester under organic chemicals.Q: What process should be followed in case of a Methyl Acetate spill?
A: In the event of a spill, eliminate all ignition sources and ventilate the area. Absorb the spill with a non-combustible material such as sand, then collect it in a suitable container for disposal. Follow all local regulations for flammable liquids when handling spills.
Tell us about your requirement
Price:
Quantity
Select Unit
- 50
- 100
- 200
- 250
- 500
- 1000+
Additional detail
Mobile number
Email
More Products in Aliphatic Bromide Category
Lithium Acetate Dihydrate
Minimum Order Quantity : 1 Kilograms
Molecular Formula : C2H3LiO22H2O
Application : Used in biochemical research and as a lithium source
Usage : Preparation of lithiumbased compounds; biochemical applications
Structural Formula : LiC2H3O22H2O
Smell : Odorless, Other
Isopropyl Bromide
Minimum Order Quantity : 1 Kilograms
Molecular Formula : C3H7Br
Application : Pharmaceutical intermediates, Organic synthesis, Analytical reagent
Usage : Used as alkylating agent and in organic syntheses
Structural Formula : CH3CHBrCH3
Smell : Other, Sweet, pleasant odor
Methyl - 3 - Oxopentanoate
Minimum Order Quantity : 1 Kilograms
Molecular Formula : C6H10O3
Application : Pharmaceutical intermediates, chemical synthesis
Usage : Used in the preparation of pharmaceuticals, agrochemicals, and dyes
Structural Formula : CH3COCH2COOCH3
Smell : Other, Fruity, pleasant odor
2-Ethyl Hexyl Bromide
Minimum Order Quantity : 1 Kilograms
Molecular Formula : C8H17Br
Application : Used as an intermediate in chemical synthesis
Usage : Organic synthesis and pharmaceutical intermediate
Structural Formula : CH3(CH2)3CH(C2H5)CH2Br
Smell : Other, Characteristic odor
SONTARA ORGANO INDUSTRIES
GST : 27AAKFS5792F1ZP
GST : 27AAKFS5792F1ZP
Mr. Mukesh B. Parekh
(Partner)
Mobile : 08045479213
Unit 1 :W-6, M.I.D.C., Chemical Zone, Ambernath (W),
Ambernath - 421501, Maharashtra, India
Send InquiryQuick Link
Developed and Managed by Infocom Network Private Limited.
English
Spanish
French
German
Italian
Chinese (Simplified)
Japanese
Korean
Arabic
Portuguese