About 1,2,3 à¤à¥à¤°à¤¾à¤à¤¬à¥à¤°à¥à¤®à¥à¤ªà¥à¤°à¥à¤ªà¥à¤¨
| Name of Product | 1,2,3-Tribromo Propane |
| CAS No | 96-11-7 |
| Formula | C3H5Br3 |
| IUPAC Name | 1,2,3-tribromopropane |
| InChI | InChI=1S/C3H5Br3/c4-1-3(6)2-5/h3H,1-2H2 |
| InChI Key | FHCLGDLYRUPKAM-UHFFFAOYSA-N |
| Canonical SMILES | C(C(CBr)Br)Br |
| EC Number | 202-478-8 |
| UNII | D2R8L96TOV |
|
|
| Description | Clear colorless To Yellow Liquid |
| Purity ( by GC) | Not less than 98.0 % |
| Water (KF) | Not more than 0.1 % |
| Acidity | Not more than 0.1 % |
| Other name / synonyms |
|
| 1,2,3-TRIBROMOPROPANE |
| s-Tribromopropane |
| Glyceryl tribromohydrin |
| 96-11-7 |
| sym-Tribromopropane |
| Glycerol tribromohydrin |
| Propane, 1,2,3-tribromo- |
| CCRIS 6706 |
| EINECS 202-478-8 |
| NSC 78932 |
| BRN 1732082 |
| AI3-18135 |
| 1,3-Tribromopropane |
| Propane,2,3-tribromo- |
| AC1L1OES |
| 1,2,3-tribromo-propane |
| UNII-D2R8L96TOV |
| AC1Q27JA |
| D2R8L96TOV |
| NCIOpen2_004459 |
| SCHEMBL66165 |
| KSC491K9T |
| ACMC-20978r |
| 148474_ALDRICH |
| AC1Q27J9 |
| CHEBI:18859 |
| CTK3J1599 |
| FHCLGDLYRUPKAM-UHFFFAOYSA-N |
| MolPort-001-779-772 |
| NSC78932 |
| ANW-13657 |
| NSC-78932 |
| AKOS000120060 |
| MCULE-7323713039 |
| RL06082 |
| RTR-038601 |
| DB-057620 |
| KB-148139 |
| LS-121073 |
| TR-038601 |
| FT-0606223 |
| ST50409751 |
| Unavailable - See ASDI_CatNo 500027841 |
| 4-01-00-00221 (Beilstein Handbook Reference) |
| I14-0910 |
| InChI=1/C3H5Br3/c4-1-3(6)2-5/h3H,1-2H |
| 3B3-036541 |
Chemical Properties and Safety Information1,2,3-Tribromopropane is a stable compound with a boiling point of 218219C and a melting point of 4C. Its vapor pressure is relatively low (0.23 mmHg at 20C), reducing the risk of rapid evaporation. This substance should be handled with care as it can cause skin and eye irritation and is harmful if swallowed. Protective gloves, safety glasses, and proper protective clothing are strongly advised during handling.
Applications and UsesThis compound plays a vital role in organic chemistry as a reagent and solvent. It is commonly used in chemical research, synthesis of flame retardants, pharmaceuticals, and other organic compounds. Its highly pure composition makes it suitable for laboratory analysis and industrial applications alike. Its solubility in organic solvents broadens its versatility within specialized synthesis processes.
Packaging, Storage, and Handling1,2,3-Tribromopropane is packaged in bottles, drums, or customized containers per customer requirements. Proper storage involves keeping it in a cool, dry, and well-ventilated space away from ignition sources. The product maintains a shelf life of 24 months if kept in its original sealed packaging. All personnel should adhere to recommended safety precautions when storing or transferring the product.
FAQs of 1,2,3 Tribromopropane:
Q: How should 1,2,3-Tribromopropane be stored to maintain its stability and shelf life?
A: 1,2,3-Tribromopropane should be stored in a cool, dry, and well-ventilated area, away from sources of ignition. Keeping it in tightly sealed original containers will maintain its stability and ensure a shelf life of up to 24 months.
Q: What are the recommended protective measures when handling this chemical?
A: It is important to wear protective gloves, safety glasses, and suitable protective clothing when handling 1,2,3-Tribromopropane to prevent skin and eye irritation and reduce the risk of accidental ingestion.
Q: Where is 1,2,3-Tribromopropane commonly used and what benefits does it offer?
A: This compound is widely used in organic synthesis, chemical research, as a solvent, and as an intermediate in the production of pharmaceuticals and flame retardants. Its high purity and reliable performance make it valuable in both industrial and laboratory settings.
Q: What is the process for manufacturing 1,2,3-Tribromopropane?
A: 1,2,3-Tribromopropane is typically derived from propane through a bromination process, resulting in a halogenated hydrocarbon suitable for various chemical applications.
Q: When can I expect the product to degrade or require replacement?
A: If stored properly in its original sealed container, 1,2,3-Tribromopropane retains its properties for 24 months. After this period, it is advisable to inspect or replace the stock to ensure efficacy and safety.
Q: Is 1,2,3-Tribromopropane soluble in water?
A: No, 1,2,3-Tribromopropane is insoluble in water but dissolves well in organic solvents such as chloroform, ether, and carbon tetrachloride, which enhances its utility in various chemical processes.