About Isopropyl Chloro Acetate
| Name of Product | Isopropyl Chloro Acetate |
| IUPAC Name | propan-2-yl 2-chloroacetate |
| CAS No | 105-48-6 |
| InChI | InChI=1S/C5H9ClO2/c1-4(2)8-5(7)3-6/h4H,3H2,1-2H3 |
| Formula | C5H9ClO2 |
| InChI Key | VODRWDBLLGYRJT-UHFFFAOYSA-N |
| Other name / synonyms | ISOPROPYL CHLOROACETATE |
| Canonical SMILES | CC(C)OC(=O)CCl |
| Chloroacetic acid isopropyl ester |
| EC Number | 203-301-7 |
| 105-48-6 |
| UN Number | 2947 |
| propan-2-yl 2-chloroacetate |
|
|
|
| Acetic acid, chloro-, 1-methylethyl ester |
| Description | Clear, colourless liquid |
| iso-propyl chloroacetate |
| Purity by GC | Not less than 99.0% |
| ClCH2C(O)OCH(CH3)2 |
| Acidity | Not more than 0.1 % |
| CCRIS 7748 |
| Water | Not more than 0.2 % |
| VODRWDBLLGYRJT-UHFFFAOYSA-N |
|
|
|
| EINECS 203-301-7 |
|
|
|
| Monochloroacetic acid isopropyl ester |
|
|
|
| NSC 27789 |
|
|
|
| SBB040600 |
|
|
|
| UN2947 |
|
|
|
| Acetic acid, chloro-, isopropyl ester |
|
|
|
| AI3-39184 |
|
|
|
| Acetic acid, 2-chloro-, 1-methylethyl ester |
|
|
|
| AC1L1PHL |
|
|
|
| AC1Q3TQC |
|
|
|
| isopropyl 2-chloroacetate |
|
|
|
| ACMC-2098gh |
|
|
|
| methylethyl 2-chloroacetate |
|
|
|
| KSC492K2D |
|
|
|
| SCHEMBL136589 |
|
|
|
| Jsp000514 |
|
|
|
| CTK3J2521 |
|
|
|
| VODRWDBLLGYRJT-UHFFFAOYSA- |
|
|
|
| MolPort-000-871-655 |
|
|
|
| Chloroacetic acid, 1-methyl ester |
|
|
|
| NSC27789 |
|
|
|
| ANW-15231 |
|
|
|
| AR-1J2764 |
|
|
|
| NSC-27789 |
|
|
|
| ZINC01641625 |
|
|
|
| AKOS000268764 |
|
|
|
| chloroacetic acid, 1-methylethyl ester |
|
|
|
| MCULE-3017211046 |
|
|
|
| UN 2947 |
|
|
|
| CJ-05889 |
|
|
|
| CJ-26498 |
|
|
|
| LS-188102 |
|
|
|
| RT-000697 |
|
|
|
| FT-0656095 |
|
|
|
| Acetic acid, chloro-, isopropyl ester (8CI) |
|
|
|
| I14-5876 |
|
|
|
| Isopropyl chloroacetate [UN2947] [Flammable liquid] |
|
|
|
| Isopropyl chloroacetate [UN2947] [Flammable liquid] |
|
|
|
| 3B3-054600 |
|
|
|
| InChI=1/C5H9ClO2/c1-4(2)8-5(7)3-6/h4H,3H2,1-2H3 |
|
|
|
|
|
|
|
|
Superior Quality and PurityIsopropyl Chloro Acetate is produced using stringent quality measures, resulting in a minimum purity of 98%. Its high-grade composition suits critical organic synthesis processes in pharmaceutical and agrochemical industries. The substances neutral pH and stability under prescribed storage conditions make it a reliable option for customers seeking consistency and performance.
Packaging and Transport OptionsAvailable in 200 kg HDPE drums, IBC tanks, or customized packaging, Isopropyl Chloro Acetate offers flexible shipment solutions. Classified under UN 1993 as a Class 3 flammable liquid, it is shipped in compliance with international transport regulations, ensuring safe and secure delivery to destinations worldwide, primarily exported from India.
Safe Handling and StorageProper handling and storage of Isopropyl Chloro Acetate preserve its shelf life and efficacy. The compound is stable for two years if stored tightly closed in a cool, dry, well-ventilated area, away from direct sunlight and under an inert atmosphere. Following these guidelines helps prevent degradation and exposure risks.
FAQs of Isopropyl Chloro Acetate:
Q: How should Isopropyl Chloro Acetate be stored for maximum stability?
A: Isopropyl Chloro Acetate should always be kept tightly closed in a cool, dry, and well-ventilated area, away from any direct sunlight. Storing the substance under an inert atmosphere optimizes stability and ensures it maintains its efficacy during its two-year shelf life.
Q: What are the main applications of Isopropyl Chloro Acetate?
A: This compound is primarily used as an intermediate in the production of pharmaceuticals and agrochemicals. It plays a key role in various organic synthesis processes, where its high purity and reliable stability are particularly valuable.
Q: When is it necessary to use specialized packaging for Isopropyl Chloro Acetate?
A: Specialized packaging such as 200 kg HDPE drums or IBC tanks is recommended whenever larger volumes are transported or stored, especially due to the compounds classification as a flammable liquid under UN 1993, Class 3. Custom packaging can also be arranged for specific customer needs.
Q: Where should Isopropyl Chloro Acetate not be stored to prevent product degradation?
A: This chemical should not be stored in areas exposed to direct sunlight, heat sources, or moisture. It is essential to avoid water contact, as the substance is immiscible with water and is best maintained in dry conditions.
Q: What safety precautions should be considered when handling Isopropyl Chloro Acetate?
A: Since Isopropyl Chloro Acetate is classified as an irritant and harmful substance, appropriate personal protective equipment (PPE) such as gloves, goggles, and protective clothing should be worn. Ensure excellent ventilation, and avoid inhalation, direct skin, or eye contact.
Q: How does Isopropyl Chloro Acetate benefit the pharmaceutical and agrochemical industries?
A: Its high purity, stability, and reliable reactivity make Isopropyl Chloro Acetate an ideal intermediate for producing active ingredients. This supports more efficient manufacturing processes and results in higher-quality end products for both industries.